C14H22N4O3 — CID 82990107
N-ethyl-4-nitro-3-[2-(propylamino)ethylamino]benzamide (PubChem CID 82990107) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is N-ethyl-4-nitro-3-[2-(propylamino)ethylamino]benzamide.
| Compound Name | N-ethyl-4-nitro-3-[2-(propylamino)ethylamino]benzamide |
|---|---|
| PubChem CID | 82990107 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-ethyl-4-nitro-3-[2-(propylamino)ethylamino]benzamide |
| SMILES | CCCNCCNc1cc(C(=O)NCC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N4O3/c1-3-7-15-8-9-17-12-10-11(14(19)16-4-2)5-6-13(12)18(20)21/h5-6,10,15,17H,3-4,7-9H2,1-2H3,(H,16,19) |
| InChIKey | IFNCEKXNSVXCAX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|