C13H15N5O3 — CID 82991748
N-ethyl-3-nitro-4-(1H-pyrazol-4-ylmethylamino)benzamide (PubChem CID 82991748) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-ethyl-3-nitro-4-(1H-pyrazol-4-ylmethylamino)benzamide.
| Compound Name | N-ethyl-3-nitro-4-(1H-pyrazol-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 82991748 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-ethyl-3-nitro-4-(1H-pyrazol-4-ylmethylamino)benzamide |
| SMILES | CCNC(=O)c1ccc(NCc2cn[nH]c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N5O3/c1-2-14-13(19)10-3-4-11(12(5-10)18(20)21)15-6-9-7-16-17-8-9/h3-5,7-8,15H,2,6H2,1H3,(H,14,19)(H,16,17) |
| InChIKey | WWIIFNMFAIVBDJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|