C11H14F2N2O2 — CID 82992258
3-amino-4-(2,2-difluoroethoxy)-N,N-dimethylbenzamide (PubChem CID 82992258) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 3-amino-4-(2,2-difluoroethoxy)-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-(2,2-difluoroethoxy)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 82992258 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-amino-4-(2,2-difluoroethoxy)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(OCC(F)F)c(N)c1 |
| InChI | InChI=1S/C11H14F2N2O2/c1-15(2)11(16)7-3-4-9(8(14)5-7)17-6-10(12)13/h3-5,10H,6,14H2,1-2H3 |
| InChIKey | ZPDGXFPRVZQPLT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|