C13H20N6O2 — CID 82992781
8-(3,3-dimethylpiperazin-1-yl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 82992781) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 8-(3,3-dimethylpiperazin-1-yl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(3,3-dimethylpiperazin-1-yl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 82992781 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 8-(3,3-dimethylpiperazin-1-yl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(N3CCNC(C)(C)C3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H20N6O2/c1-13(2)7-19(6-5-14-13)11-15-8-9(16-11)17(3)12(21)18(4)10(8)20/h14H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | DGWHXTIIKYDEEP-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |