C13H18N4O4 — CID 82992823
N-methyl-4-nitro-3-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]benzamide (PubChem CID 82992823) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-methyl-4-nitro-3-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]benzamide.
| Compound Name | N-methyl-4-nitro-3-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 82992823 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N-methyl-4-nitro-3-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]benzamide |
| SMILES | CNC(=O)c1ccc([N+](=O)[O-])c(NCC(=O)NC(C)C)c1 |
| InChI | InChI=1S/C13H18N4O4/c1-8(2)16-12(18)7-15-10-6-9(13(19)14-3)4-5-11(10)17(20)21/h4-6,8,15H,7H2,1-3H3,(H,14,19)(H,16,18) |
| InChIKey | PPSSWLZHMJQHHG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|