C15H23N3OS — CID 82992962
3-amino-N,N-dimethyl-4-[(2-methylthiolan-2-yl)methylamino]benzamide (PubChem CID 82992962) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-4-[(2-methylthiolan-2-yl)methylamino]benzamide.
| Compound Name | 3-amino-N,N-dimethyl-4-[(2-methylthiolan-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 82992962 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-amino-N,N-dimethyl-4-[(2-methylthiolan-2-yl)methylamino]benzamide |
| SMILES | CN(C)C(=O)c1ccc(NCC2(C)CCCS2)c(N)c1 |
| InChI | InChI=1S/C15H23N3OS/c1-15(7-4-8-20-15)10-17-13-6-5-11(9-12(13)16)14(19)18(2)3/h5-6,9,17H,4,7-8,10,16H2,1-3H3 |
| InChIKey | YHVWNTCVXLRVTM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|