C10H18N4O2 — CID 82993556
N-[2-(2-methoxyethylamino)ethyl]-1-methylpyrazole-4-carboxamide (PubChem CID 82993556) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 82993556 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-1-methylpyrazole-4-carboxamide |
| SMILES | COCCNCCNC(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C10H18N4O2/c1-14-8-9(7-13-14)10(15)12-4-3-11-5-6-16-2/h7-8,11H,3-6H2,1-2H3,(H,12,15) |
| InChIKey | KMPYOQSELFELGX-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|