C12H18N4O2 — CID 82994052
3,3-dimethyl-1-(6-methyl-5-nitro-2-pyridinyl)piperazine (PubChem CID 82994052) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3,3-dimethyl-1-(6-methyl-5-nitro-2-pyridinyl)piperazine.
| Compound Name | 3,3-dimethyl-1-(6-methyl-5-nitro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 82994052 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3,3-dimethyl-1-(6-methyl-5-nitro-2-pyridinyl)piperazine |
| SMILES | Cc1nc(N2CCNC(C)(C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O2/c1-9-10(16(17)18)4-5-11(14-9)15-7-6-13-12(2,3)8-15/h4-5,13H,6-8H2,1-3H3 |
| InChIKey | NNSIDVVXQBSSQY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|