C14H20N2O2S — CID 82994159
N-[2-(2-methoxyethylamino)ethyl]-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 82994159) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 82994159 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCNCCNC(=O)C1CSc2ccccc21 |
| InChI | InChI=1S/C14H20N2O2S/c1-18-9-8-15-6-7-16-14(17)12-10-19-13-5-3-2-4-11(12)13/h2-5,12,15H,6-10H2,1H3,(H,16,17) |
| InChIKey | HHSLAKYCUPRXOE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|