About 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine
1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine (PubChem CID 82994311) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine |
| PubChem CID | 82994311 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine |
| SMILES | CCOc1cc(N2CCNC(C)(C)C2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H21N3O3/c1-4-20-13-8-11(7-12(9-13)17(18)19)16-6-5-15-14(2,3)10-16/h7-9,15H,4-6,10H2,1-3H3 |
| InChIKey | JNYUMHPSDHGEIB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine?
The IUPAC name of 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine (CID 82994311) is 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine.
What is the SMILES notation for 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine?
The canonical SMILES for 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine is CCOc1cc(N2CCNC(C)(C)C2)cc([N+](=O)[O-])c1.
What is the InChIKey of 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine?
The InChIKey is JNYUMHPSDHGEIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3/c1-4-20-13-8-11(7-12(9-13)17(18)19)16-6-5-15-14(2,3)10-16/h7-9,15H,4-6,10H2,1-3H3.
What are the key properties of 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine?
1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine has a molecular weight of 279.34 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxy-5-nitrophenyl)-3,3-dimethylpiperazine is sourced from PubChem (CID 82994311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).