C12H16N4O3 — CID 82994983
3-[3-(aminomethyl)pyrrolidin-1-yl]-4-nitrobenzamide (PubChem CID 82994983) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[3-(aminomethyl)pyrrolidin-1-yl]-4-nitrobenzamide.
| Compound Name | 3-[3-(aminomethyl)pyrrolidin-1-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 82994983 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-[3-(aminomethyl)pyrrolidin-1-yl]-4-nitrobenzamide |
| SMILES | NCC1CCN(c2cc(C(N)=O)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H16N4O3/c13-6-8-3-4-15(7-8)11-5-9(12(14)17)1-2-10(11)16(18)19/h1-2,5,8H,3-4,6-7,13H2,(H2,14,17) |
| InChIKey | ZYNWQAFLDYWWLX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|