About 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one
2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one (PubChem CID 82996602) has the molecular formula C6H9N3O3S
and a molecular weight of 203.22 g/mol. Its IUPAC name is 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one.
Molecular Properties
| Compound Name | 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one |
| PubChem CID | 82996602 |
| Molecular Formula | C6H9N3O3S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one |
| SMILES | NC1=NC2(CCS(=O)(=O)C2)C(=O)N1 |
| InChI | InChI=1S/C6H9N3O3S/c7-5-8-4(10)6(9-5)1-2-13(11,12)3-6/h1-3H2,(H3,7,8,9,10) |
| InChIKey | NEVRFELUWLSCBU-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one?
The IUPAC name of 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one (CID 82996602) is 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one.
What is the SMILES notation for 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one?
The canonical SMILES for 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one is NC1=NC2(CCS(=O)(=O)C2)C(=O)N1.
What is the InChIKey of 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one?
The InChIKey is NEVRFELUWLSCBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3S/c7-5-8-4(10)6(9-5)1-2-13(11,12)3-6/h1-3H2,(H3,7,8,9,10).
What are the key properties of 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one?
2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one has a molecular weight of 203.22 g/mol, XLogP of -2.01, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,7-dioxo-7λ6-thia-1,3-diazaspiro[4.4]non-1-en-4-one is sourced from PubChem (CID 82996602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).