About 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one
1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one (PubChem CID 82996710) has the molecular formula C13H20N4O
and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one |
| PubChem CID | 82996710 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one |
| SMILES | CC1(C)CN(c2nccn(C3CC3)c2=O)CCN1 |
| InChI | InChI=1S/C13H20N4O/c1-13(2)9-16(7-6-15-13)11-12(18)17(8-5-14-11)10-3-4-10/h5,8,10,15H,3-4,6-7,9H2,1-2H3 |
| InChIKey | RHEUINVBDKUPCX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one?
The IUPAC name of 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one (CID 82996710) is 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one.
What is the SMILES notation for 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one?
The canonical SMILES for 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one is CC1(C)CN(c2nccn(C3CC3)c2=O)CCN1.
What is the InChIKey of 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one?
The InChIKey is RHEUINVBDKUPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O/c1-13(2)9-16(7-6-15-13)11-12(18)17(8-5-14-11)10-3-4-10/h5,8,10,15H,3-4,6-7,9H2,1-2H3.
What are the key properties of 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one?
1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one has a molecular weight of 248.33 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(3,3-dimethylpiperazin-1-yl)pyrazin-2-one is sourced from PubChem (CID 82996710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).