About 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one
2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one (PubChem CID 82997968) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one.
Molecular Properties
| Compound Name | 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one |
| PubChem CID | 82997968 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one |
| SMILES | O=C1NC(=S)NC12CCOC2 |
| InChI | InChI=1S/C6H8N2O2S/c9-4-6(1-2-10-3-6)8-5(11)7-4/h1-3H2,(H2,7,8,9,11) |
| InChIKey | YKYNNNFLDIDBLN-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one?
The IUPAC name of 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one (CID 82997968) is 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one.
What is the SMILES notation for 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one?
The canonical SMILES for 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one is O=C1NC(=S)NC12CCOC2.
What is the InChIKey of 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one?
The InChIKey is YKYNNNFLDIDBLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c9-4-6(1-2-10-3-6)8-5(11)7-4/h1-3H2,(H2,7,8,9,11).
What are the key properties of 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one?
2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one has a molecular weight of 172.21 g/mol, XLogP of -0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one is sourced from PubChem (CID 82997968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).