C13H10ClN3 — CID 829981
7-chloro-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole (PubChem CID 829981) has the molecular formula C13H10ClN3 and a molecular weight of 243.70 g/mol. Its IUPAC name is 7-chloro-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole.
| Compound Name | 7-chloro-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole |
|---|---|
| PubChem CID | 829981 |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 7-chloro-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole |
| SMILES | Clc1ccc2[nH]c3c(c2c1)CCc1cn[nH]c1-3 |
| InChI | InChI=1S/C13H10ClN3/c14-8-2-4-11-10(5-8)9-3-1-7-6-15-17-12(7)13(9)16-11/h2,4-6,16H,1,3H2,(H,15,17) |
| InChIKey | PLOLFTFTXWLIRO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|