About 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one
4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one (PubChem CID 82998969) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one |
| PubChem CID | 82998969 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one |
| SMILES | CC(C)(C)NC1=NC(C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C11H21N3O/c1-10(2,3)7-8(15)13-9(12-7)14-11(4,5)6/h7H,1-6H3,(H2,12,13,14,15) |
| InChIKey | ADWTWXIQVDAWSA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one?
The IUPAC name of 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one (CID 82998969) is 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one?
The canonical SMILES for 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one is CC(C)(C)NC1=NC(C(C)(C)C)C(=O)N1.
What is the InChIKey of 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one?
The InChIKey is ADWTWXIQVDAWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-10(2,3)7-8(15)13-9(12-7)14-11(4,5)6/h7H,1-6H3,(H2,12,13,14,15).
What are the key properties of 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one?
4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one has a molecular weight of 211.31 g/mol, XLogP of 1.27, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-(tert-butylamino)-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 82998969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).