About 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide
3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide (PubChem CID 82999507) has the molecular formula C11H10N6O
and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide.
Molecular Properties
| Compound Name | 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide |
| PubChem CID | 82999507 |
| Molecular Formula | C11H10N6O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-n2cnc(C#N)n2)c(N)c1 |
| InChI | InChI=1S/C11H10N6O/c1-14-11(18)7-2-3-9(8(13)4-7)17-6-15-10(5-12)16-17/h2-4,6H,13H2,1H3,(H,14,18) |
| InChIKey | PRJRLFGZKSZWKB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide?
The IUPAC name of 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide (CID 82999507) is 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide.
What is the SMILES notation for 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide?
The canonical SMILES for 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide is CNC(=O)c1ccc(-n2cnc(C#N)n2)c(N)c1.
What is the InChIKey of 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide?
The InChIKey is PRJRLFGZKSZWKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6O/c1-14-11(18)7-2-3-9(8(13)4-7)17-6-15-10(5-12)16-17/h2-4,6H,13H2,1H3,(H,14,18).
What are the key properties of 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide?
3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide has a molecular weight of 242.24 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-(3-cyano-1,2,4-triazol-1-yl)-N-methylbenzamide is sourced from PubChem (CID 82999507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).