C13H19N3O4 — CID 82999750
4-(2-amino-2-methylbutoxy)-N-methyl-3-nitrobenzamide (PubChem CID 82999750) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-(2-amino-2-methylbutoxy)-N-methyl-3-nitrobenzamide.
| Compound Name | 4-(2-amino-2-methylbutoxy)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 82999750 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-(2-amino-2-methylbutoxy)-N-methyl-3-nitrobenzamide |
| SMILES | CCC(C)(N)COc1ccc(C(=O)NC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O4/c1-4-13(2,14)8-20-11-6-5-9(12(17)15-3)7-10(11)16(18)19/h5-7H,4,8,14H2,1-3H3,(H,15,17) |
| InChIKey | ZXFGQDDFUBBLFC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|