C14H24N2O4 — CID 83000799
4,5-dimethoxy-2-N,2-N-bis(2-methoxyethyl)benzene-1,2-diamine (PubChem CID 83000799) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4,5-dimethoxy-2-N,2-N-bis(2-methoxyethyl)benzene-1,2-diamine.
| Compound Name | 4,5-dimethoxy-2-N,2-N-bis(2-methoxyethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 83000799 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4,5-dimethoxy-2-N,2-N-bis(2-methoxyethyl)benzene-1,2-diamine |
| SMILES | COCCN(CCOC)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C14H24N2O4/c1-17-7-5-16(6-8-18-2)12-10-14(20-4)13(19-3)9-11(12)15/h9-10H,5-8,15H2,1-4H3 |
| InChIKey | AOUZTFBLKQSXEF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|