About 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine
2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine (PubChem CID 83001040) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine |
| PubChem CID | 83001040 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine |
| SMILES | CCN(c1cc(OC)c(OC)cc1N)C1CC1 |
| InChI | InChI=1S/C13H20N2O2/c1-4-15(9-5-6-9)11-8-13(17-3)12(16-2)7-10(11)14/h7-9H,4-6,14H2,1-3H3 |
| InChIKey | DFPQPDFTRZFYJE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine?
The IUPAC name of 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine (CID 83001040) is 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine.
What is the SMILES notation for 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine?
The canonical SMILES for 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine is CCN(c1cc(OC)c(OC)cc1N)C1CC1.
What is the InChIKey of 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine?
The InChIKey is DFPQPDFTRZFYJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-4-15(9-5-6-9)11-8-13(17-3)12(16-2)7-10(11)14/h7-9H,4-6,14H2,1-3H3.
What are the key properties of 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine?
2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine has a molecular weight of 236.31 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-cyclopropyl-2-N-ethyl-4,5-dimethoxybenzene-1,2-diamine is sourced from PubChem (CID 83001040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).