About 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline
6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 83002078) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 83002078 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | COCCN1CCNc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C13H20N2O3/c1-16-7-6-15-5-4-14-10-8-12(17-2)13(18-3)9-11(10)15/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | QAHRGZAKQJIFFU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline (CID 83002078) is 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline is COCCN1CCNc2cc(OC)c(OC)cc21.
What is the InChIKey of 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline?
The InChIKey is QAHRGZAKQJIFFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-16-7-6-15-5-4-14-10-8-12(17-2)13(18-3)9-11(10)15/h8-9,14H,4-7H2,1-3H3.
What are the key properties of 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline?
6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline has a molecular weight of 252.31 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-4-(2-methoxyethyl)-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 83002078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).