About 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline
2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline (PubChem CID 83002240) has the molecular formula C14H22N2OS
and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline.
Molecular Properties
| Compound Name | 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline |
| PubChem CID | 83002240 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline |
| SMILES | CC(C)Oc1cc(N2CCCSCC2)ccc1N |
| InChI | InChI=1S/C14H22N2OS/c1-11(2)17-14-10-12(4-5-13(14)15)16-6-3-8-18-9-7-16/h4-5,10-11H,3,6-9,15H2,1-2H3 |
| InChIKey | ICWBNUYZMBWWID-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline?
The IUPAC name of 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline (CID 83002240) is 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline.
What is the SMILES notation for 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline?
The canonical SMILES for 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline is CC(C)Oc1cc(N2CCCSCC2)ccc1N.
What is the InChIKey of 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline?
The InChIKey is ICWBNUYZMBWWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2OS/c1-11(2)17-14-10-12(4-5-13(14)15)16-6-3-8-18-9-7-16/h4-5,10-11H,3,6-9,15H2,1-2H3.
What are the key properties of 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline?
2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline has a molecular weight of 266.41 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxy-4-(1,4-thiazepan-4-yl)aniline is sourced from PubChem (CID 83002240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).