C13H19F2N3 — CID 83003142
1-N-(2,6-dimethylpiperidin-1-yl)-2,6-difluorobenzene-1,4-diamine (PubChem CID 83003142) has the molecular formula C13H19F2N3 and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-N-(2,6-dimethylpiperidin-1-yl)-2,6-difluorobenzene-1,4-diamine.
| Compound Name | 1-N-(2,6-dimethylpiperidin-1-yl)-2,6-difluorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 83003142 |
| Molecular Formula | C13H19F2N3 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-N-(2,6-dimethylpiperidin-1-yl)-2,6-difluorobenzene-1,4-diamine |
| SMILES | CC1CCCC(C)N1Nc1c(F)cc(N)cc1F |
| InChI | InChI=1S/C13H19F2N3/c1-8-4-3-5-9(2)18(8)17-13-11(14)6-10(16)7-12(13)15/h6-9,17H,3-5,16H2,1-2H3 |
| InChIKey | GHZRKBFJIONIFV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|