About 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine
2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine (PubChem CID 83003215) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine |
| PubChem CID | 83003215 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine |
| SMILES | CC(C)COC1CC(NN(C)C)C1(C)C |
| InChI | InChI=1S/C12H26N2O/c1-9(2)8-15-11-7-10(12(11,3)4)13-14(5)6/h9-11,13H,7-8H2,1-6H3 |
| InChIKey | IDLGNSPRQJPLJS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine?
The IUPAC name of 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine (CID 83003215) is 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine.
What is the SMILES notation for 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine?
The canonical SMILES for 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine is CC(C)COC1CC(NN(C)C)C1(C)C.
What is the InChIKey of 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine?
The InChIKey is IDLGNSPRQJPLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-9(2)8-15-11-7-10(12(11,3)4)13-14(5)6/h9-11,13H,7-8H2,1-6H3.
What are the key properties of 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine?
2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine has a molecular weight of 214.35 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-1,1-dimethylhydrazine is sourced from PubChem (CID 83003215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).