About 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole
2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole (PubChem CID 83003669) has the molecular formula C16H23ClN2O2
and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole.
Molecular Properties
| Compound Name | 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole |
| PubChem CID | 83003669 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole |
| SMILES | CCC(C)(C)n1c(C(C)Cl)nc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C16H23ClN2O2/c1-7-16(3,4)19-12-9-14(21-6)13(20-5)8-11(12)18-15(19)10(2)17/h8-10H,7H2,1-6H3 |
| InChIKey | XZAOECQXWGQBFS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole?
The IUPAC name of 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole (CID 83003669) is 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole.
What is the SMILES notation for 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole?
The canonical SMILES for 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole is CCC(C)(C)n1c(C(C)Cl)nc2cc(OC)c(OC)cc21.
What is the InChIKey of 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole?
The InChIKey is XZAOECQXWGQBFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN2O2/c1-7-16(3,4)19-12-9-14(21-6)13(20-5)8-11(12)18-15(19)10(2)17/h8-10H,7H2,1-6H3.
What are the key properties of 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole?
2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole has a molecular weight of 310.83 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethyl)-5,6-dimethoxy-1-(2-methylbutan-2-yl)benzimidazole is sourced from PubChem (CID 83003669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).