About 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine
3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine (PubChem CID 83003966) has the molecular formula C10H13F2N3O
and a molecular weight of 229.23 g/mol. Its IUPAC name is 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine |
| PubChem CID | 83003966 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine |
| SMILES | Nc1ccc(F)c(F)c1NN1CCOCC1 |
| InChI | InChI=1S/C10H13F2N3O/c11-7-1-2-8(13)10(9(7)12)14-15-3-5-16-6-4-15/h1-2,14H,3-6,13H2 |
| InChIKey | AUDOVPTZWXLJSC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine?
The IUPAC name of 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine (CID 83003966) is 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine.
What is the SMILES notation for 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine?
The canonical SMILES for 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine is Nc1ccc(F)c(F)c1NN1CCOCC1.
What is the InChIKey of 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine?
The InChIKey is AUDOVPTZWXLJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2N3O/c11-7-1-2-8(13)10(9(7)12)14-15-3-5-16-6-4-15/h1-2,14H,3-6,13H2.
What are the key properties of 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine?
3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine has a molecular weight of 229.23 g/mol, XLogP of 1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoro-2-N-morpholin-4-ylbenzene-1,2-diamine is sourced from PubChem (CID 83003966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).