About 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone
1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone (PubChem CID 83004022) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone |
| PubChem CID | 83004022 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(NN(C)C)CC1 |
| InChI | InChI=1S/C9H19N3O/c1-8(13)12-6-4-9(5-7-12)10-11(2)3/h9-10H,4-7H2,1-3H3 |
| InChIKey | IYOMBTYHWIZSGE-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone?
The IUPAC name of 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone (CID 83004022) is 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone?
The canonical SMILES for 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone is CC(=O)N1CCC(NN(C)C)CC1.
What is the InChIKey of 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone?
The InChIKey is IYOMBTYHWIZSGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-8(13)12-6-4-9(5-7-12)10-11(2)3/h9-10H,4-7H2,1-3H3.
What are the key properties of 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone?
1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone has a molecular weight of 185.27 g/mol, XLogP of 0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2-dimethylhydrazinyl)piperidin-1-yl]ethanone is sourced from PubChem (CID 83004022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).