C9H16N4O2 — CID 83004176
5-[(2,2-dimethylhydrazinyl)methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 83004176) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-[(2,2-dimethylhydrazinyl)methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[(2,2-dimethylhydrazinyl)methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 83004176 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5-[(2,2-dimethylhydrazinyl)methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CN(C)NCc1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H16N4O2/c1-11(2)10-5-7-6-12(3)9(15)13(4)8(7)14/h6,10H,5H2,1-4H3 |
| InChIKey | SAFFQOKGDWMKIH-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|