C16H20N2O3 — CID 83004428
4,5-dimethoxy-2-N-[3-(methoxymethyl)phenyl]benzene-1,2-diamine (PubChem CID 83004428) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4,5-dimethoxy-2-N-[3-(methoxymethyl)phenyl]benzene-1,2-diamine.
| Compound Name | 4,5-dimethoxy-2-N-[3-(methoxymethyl)phenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 83004428 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4,5-dimethoxy-2-N-[3-(methoxymethyl)phenyl]benzene-1,2-diamine |
| SMILES | COCc1cccc(Nc2cc(OC)c(OC)cc2N)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-19-10-11-5-4-6-12(7-11)18-14-9-16(21-3)15(20-2)8-13(14)17/h4-9,18H,10,17H2,1-3H3 |
| InChIKey | UQYAVBUKDKJHAT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|