C17H27NO3 — CID 83005080
4,5-dimethoxy-2-(3,3,5-trimethylcyclohexyl)oxyaniline (PubChem CID 83005080) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(3,3,5-trimethylcyclohexyl)oxyaniline.
| Compound Name | 4,5-dimethoxy-2-(3,3,5-trimethylcyclohexyl)oxyaniline |
|---|---|
| PubChem CID | 83005080 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 4,5-dimethoxy-2-(3,3,5-trimethylcyclohexyl)oxyaniline |
| SMILES | COc1cc(N)c(OC2CC(C)CC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C17H27NO3/c1-11-6-12(10-17(2,3)9-11)21-14-8-16(20-5)15(19-4)7-13(14)18/h7-8,11-12H,6,9-10,18H2,1-5H3 |
| InChIKey | XLYMVPBKQXLNTF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|