About 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine
2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine (PubChem CID 83005215) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine |
| PubChem CID | 83005215 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine |
| SMILES | CCC1(C)CC(NN(C)C)CCO1 |
| InChI | InChI=1S/C10H22N2O/c1-5-10(2)8-9(6-7-13-10)11-12(3)4/h9,11H,5-8H2,1-4H3 |
| InChIKey | DDPAVHXYUVXYGF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine?
The IUPAC name of 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine (CID 83005215) is 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine.
What is the SMILES notation for 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine?
The canonical SMILES for 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine is CCC1(C)CC(NN(C)C)CCO1.
What is the InChIKey of 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine?
The InChIKey is DDPAVHXYUVXYGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-5-10(2)8-9(6-7-13-10)11-12(3)4/h9,11H,5-8H2,1-4H3.
What are the key properties of 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine?
2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine has a molecular weight of 186.30 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-2-methyloxan-4-yl)-1,1-dimethylhydrazine is sourced from PubChem (CID 83005215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).