C9H14N4O — CID 83005603
2-N-morpholin-4-ylpyridine-2,5-diamine (PubChem CID 83005603) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-N-morpholin-4-ylpyridine-2,5-diamine.
| Compound Name | 2-N-morpholin-4-ylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 83005603 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-N-morpholin-4-ylpyridine-2,5-diamine |
| SMILES | Nc1ccc(NN2CCOCC2)nc1 |
| InChI | InChI=1S/C9H14N4O/c10-8-1-2-9(11-7-8)12-13-3-5-14-6-4-13/h1-2,7H,3-6,10H2,(H,11,12) |
| InChIKey | LNLLMIHCFBCBEE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |