C12H18N2O — CID 83005876
1,1-dimethyl-2-[(2-prop-2-enoxyphenyl)methyl]hydrazine (PubChem CID 83005876) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(2-prop-2-enoxyphenyl)methyl]hydrazine.
| Compound Name | 1,1-dimethyl-2-[(2-prop-2-enoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 83005876 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1,1-dimethyl-2-[(2-prop-2-enoxyphenyl)methyl]hydrazine |
| SMILES | C=CCOc1ccccc1CNN(C)C |
| InChI | InChI=1S/C12H18N2O/c1-4-9-15-12-8-6-5-7-11(12)10-13-14(2)3/h4-8,13H,1,9-10H2,2-3H3 |
| InChIKey | CPYWXWATLNUQKW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|