C13H27N3 — CID 83006832
2,6-dimethyl-N-(piperidin-3-ylmethyl)piperidin-1-amine (PubChem CID 83006832) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 2,6-dimethyl-N-(piperidin-3-ylmethyl)piperidin-1-amine.
| Compound Name | 2,6-dimethyl-N-(piperidin-3-ylmethyl)piperidin-1-amine |
|---|---|
| PubChem CID | 83006832 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 2,6-dimethyl-N-(piperidin-3-ylmethyl)piperidin-1-amine |
| SMILES | CC1CCCC(C)N1NCC1CCCNC1 |
| InChI | InChI=1S/C13H27N3/c1-11-5-3-6-12(2)16(11)15-10-13-7-4-8-14-9-13/h11-15H,3-10H2,1-2H3 |
| InChIKey | KZURCTDBCQULGI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |