C14H20F2N2O — CID 83007352
N-[1-[3-(difluoromethoxy)phenyl]ethyl]piperidin-1-amine (PubChem CID 83007352) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is N-[1-[3-(difluoromethoxy)phenyl]ethyl]piperidin-1-amine.
| Compound Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]piperidin-1-amine |
|---|---|
| PubChem CID | 83007352 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]piperidin-1-amine |
| SMILES | CC(NN1CCCCC1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H20F2N2O/c1-11(17-18-8-3-2-4-9-18)12-6-5-7-13(10-12)19-14(15)16/h5-7,10-11,14,17H,2-4,8-9H2,1H3 |
| InChIKey | RHBNIVAOYZIKIP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |