About 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline (PubChem CID 83008590) has the molecular formula C14H17N3O2S
and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline |
| PubChem CID | 83008590 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(Sc2nc(C)cc(C)n2)cc1OC |
| InChI | InChI=1S/C14H17N3O2S/c1-8-5-9(2)17-14(16-8)20-13-7-12(19-4)11(18-3)6-10(13)15/h5-7H,15H2,1-4H3 |
| InChIKey | OGMVEEKBJNXOQJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline (CID 83008590) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline is COc1cc(N)c(Sc2nc(C)cc(C)n2)cc1OC.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline?
The InChIKey is OGMVEEKBJNXOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2S/c1-8-5-9(2)17-14(16-8)20-13-7-12(19-4)11(18-3)6-10(13)15/h5-7H,15H2,1-4H3.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline?
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline has a molecular weight of 291.38 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-4,5-dimethoxyaniline is sourced from PubChem (CID 83008590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).