C13H19F2N3 — CID 83008977
N-[1-(2,4-difluorophenyl)ethyl]-4-methylpiperazin-1-amine (PubChem CID 83008977) has the molecular formula C13H19F2N3 and a molecular weight of 255.31 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-4-methylpiperazin-1-amine.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-4-methylpiperazin-1-amine |
|---|---|
| PubChem CID | 83008977 |
| Molecular Formula | C13H19F2N3 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-4-methylpiperazin-1-amine |
| SMILES | CC(NN1CCN(C)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H19F2N3/c1-10(12-4-3-11(14)9-13(12)15)16-18-7-5-17(2)6-8-18/h3-4,9-10,16H,5-8H2,1-2H3 |
| InChIKey | FOIGZJAUZULPGM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |