C17H24N4 — CID 83009169
2,6-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]piperidin-1-amine (PubChem CID 83009169) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]piperidin-1-amine.
| Compound Name | 2,6-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]piperidin-1-amine |
|---|---|
| PubChem CID | 83009169 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2,6-dimethyl-N-[(1-phenylpyrazol-4-yl)methyl]piperidin-1-amine |
| SMILES | CC1CCCC(C)N1NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C17H24N4/c1-14-7-6-8-15(2)21(14)19-12-16-11-18-20(13-16)17-9-4-3-5-10-17/h3-5,9-11,13-15,19H,6-8,12H2,1-2H3 |
| InChIKey | MHIGWPXOLSDSJR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |