About N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine
N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine (PubChem CID 83009210) has the molecular formula C14H26N4
and a molecular weight of 250.39 g/mol. Its IUPAC name is N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine.
Molecular Properties
| Compound Name | N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine |
| PubChem CID | 83009210 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine |
| SMILES | CCn1c(C)cc(CNN2CCN(C)CC2)c1C |
| InChI | InChI=1S/C14H26N4/c1-5-18-12(2)10-14(13(18)3)11-15-17-8-6-16(4)7-9-17/h10,15H,5-9,11H2,1-4H3 |
| InChIKey | MARXPZMNUMLYLE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 23.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine?
The IUPAC name of N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine (CID 83009210) is N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine.
What is the SMILES notation for N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine?
The canonical SMILES for N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine is CCn1c(C)cc(CNN2CCN(C)CC2)c1C.
What is the InChIKey of N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine?
The InChIKey is MARXPZMNUMLYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4/c1-5-18-12(2)10-14(13(18)3)11-15-17-8-6-16(4)7-9-17/h10,15H,5-9,11H2,1-4H3.
What are the key properties of N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine?
N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine has a molecular weight of 250.39 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methyl]-4-methylpiperazin-1-amine is sourced from PubChem (CID 83009210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).