C16H23N5 — CID 83010794
N-(4-methylpiperazin-1-yl)-1-quinolin-8-ylethane-1,2-diamine (PubChem CID 83010794) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-1-quinolin-8-ylethane-1,2-diamine.
| Compound Name | N-(4-methylpiperazin-1-yl)-1-quinolin-8-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 83010794 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-1-quinolin-8-ylethane-1,2-diamine |
| SMILES | CN1CCN(NC(CN)c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C16H23N5/c1-20-8-10-21(11-9-20)19-15(12-17)14-6-2-4-13-5-3-7-18-16(13)14/h2-7,15,19H,8-12,17H2,1H3 |
| InChIKey | SYUUPVZDGQJKKZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |