About [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine
[4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine (PubChem CID 83011706) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine.
Molecular Properties
| Compound Name | [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine |
| PubChem CID | 83011706 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine |
| SMILES | CCC1(C)CC(CN)(NN(C)C)CCO1 |
| InChI | InChI=1S/C11H25N3O/c1-5-10(2)8-11(9-12,6-7-15-10)13-14(3)4/h13H,5-9,12H2,1-4H3 |
| InChIKey | WDTANXOLDNWCLF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine?
The IUPAC name of [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine (CID 83011706) is [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine.
What is the SMILES notation for [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine?
The canonical SMILES for [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine is CCC1(C)CC(CN)(NN(C)C)CCO1.
What is the InChIKey of [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine?
The InChIKey is WDTANXOLDNWCLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O/c1-5-10(2)8-11(9-12,6-7-15-10)13-14(3)4/h13H,5-9,12H2,1-4H3.
What are the key properties of [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine?
[4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine has a molecular weight of 215.34 g/mol, XLogP of 0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-dimethylhydrazinyl)-2-ethyl-2-methyloxan-4-yl]methanamine is sourced from PubChem (CID 83011706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).