About N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine
N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine (PubChem CID 83011946) has the molecular formula C11H23N3O2S
and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine.
Molecular Properties
| Compound Name | N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine |
| PubChem CID | 83011946 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine |
| SMILES | NCC1(NN2CCCCC2)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H23N3O2S/c12-9-11(5-4-8-17(15,16)10-11)13-14-6-2-1-3-7-14/h13H,1-10,12H2 |
| InChIKey | CBDNCKXXWZEIBN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine?
The IUPAC name of N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine (CID 83011946) is N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine.
What is the SMILES notation for N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine?
The canonical SMILES for N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine is NCC1(NN2CCCCC2)CCCS(=O)(=O)C1.
What is the InChIKey of N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine?
The InChIKey is CBDNCKXXWZEIBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O2S/c12-9-11(5-4-8-17(15,16)10-11)13-14-6-2-1-3-7-14/h13H,1-10,12H2.
What are the key properties of N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine?
N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine has a molecular weight of 261.39 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine is sourced from PubChem (CID 83011946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).