C11H23N3O2S — CID 83011946
N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine (PubChem CID 83011946) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine.
| Compound Name | N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine |
|---|---|
| PubChem CID | 83011946 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[3-(aminomethyl)-1,1-dioxothian-3-yl]piperidin-1-amine |
| SMILES | NCC1(NN2CCCCC2)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H23N3O2S/c12-9-11(5-4-8-17(15,16)10-11)13-14-6-2-1-3-7-14/h13H,1-10,12H2 |
| InChIKey | CBDNCKXXWZEIBN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |