About 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine
4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine (PubChem CID 83012034) has the molecular formula C17H36N4
and a molecular weight of 296.50 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine |
| PubChem CID | 83012034 |
| Molecular Formula | C17H36N4 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.29 |
| IUPAC Name | 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine |
| SMILES | CCCN1CCCC(CN)(NN2C(C)CCCC2C)CC1 |
| InChI | InChI=1S/C17H36N4/c1-4-11-20-12-6-9-17(14-18,10-13-20)19-21-15(2)7-5-8-16(21)3/h15-16,19H,4-14,18H2,1-3H3 |
| InChIKey | WTDKYHGJYNUIHS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine?
The IUPAC name of 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine (CID 83012034) is 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine.
What is the SMILES notation for 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine?
The canonical SMILES for 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine is CCCN1CCCC(CN)(NN2C(C)CCCC2C)CC1.
What is the InChIKey of 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine?
The InChIKey is WTDKYHGJYNUIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N4/c1-4-11-20-12-6-9-17(14-18,10-13-20)19-21-15(2)7-5-8-16(21)3/h15-16,19H,4-14,18H2,1-3H3.
What are the key properties of 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine?
4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine has a molecular weight of 296.50 g/mol, XLogP of 2.35, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N-(2,6-dimethylpiperidin-1-yl)-1-propylazepan-4-amine is sourced from PubChem (CID 83012034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).