About 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine
2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine (PubChem CID 83012065) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine |
| PubChem CID | 83012065 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine |
| SMILES | CCC(C)C(CN)NN1C(C)CCCC1C |
| InChI | InChI=1S/C13H29N3/c1-5-10(2)13(9-14)15-16-11(3)7-6-8-12(16)4/h10-13,15H,5-9,14H2,1-4H3 |
| InChIKey | KKXUXFSVEGUDOV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine?
The IUPAC name of 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine (CID 83012065) is 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine.
What is the SMILES notation for 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine?
The canonical SMILES for 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine is CCC(C)C(CN)NN1C(C)CCCC1C.
What is the InChIKey of 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine?
The InChIKey is KKXUXFSVEGUDOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3/c1-5-10(2)13(9-14)15-16-11(3)7-6-8-12(16)4/h10-13,15H,5-9,14H2,1-4H3.
What are the key properties of 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine?
2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine has a molecular weight of 227.40 g/mol, XLogP of 2.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2,6-dimethylpiperidin-1-yl)-3-methylpentane-1,2-diamine is sourced from PubChem (CID 83012065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).