About N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine
N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine (PubChem CID 83012067) has the molecular formula C15H31N3S
and a molecular weight of 285.50 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine.
Molecular Properties
| Compound Name | N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine |
| PubChem CID | 83012067 |
| Molecular Formula | C15H31N3S |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine |
| SMILES | CC1CCCC(C)N1NC1(CN)CSCC(C)(C)C1 |
| InChI | InChI=1S/C15H31N3S/c1-12-6-5-7-13(2)18(12)17-15(9-16)8-14(3,4)10-19-11-15/h12-13,17H,5-11,16H2,1-4H3 |
| InChIKey | QQRUEQQRPBBZBI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine?
The IUPAC name of N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine (CID 83012067) is N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine.
What is the SMILES notation for N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine?
The canonical SMILES for N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine is CC1CCCC(C)N1NC1(CN)CSCC(C)(C)C1.
What is the InChIKey of N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine?
The InChIKey is QQRUEQQRPBBZBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3S/c1-12-6-5-7-13(2)18(12)17-15(9-16)8-14(3,4)10-19-11-15/h12-13,17H,5-11,16H2,1-4H3.
What are the key properties of N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine?
N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine has a molecular weight of 285.50 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(aminomethyl)-5,5-dimethylthian-3-yl]-2,6-dimethylpiperidin-1-amine is sourced from PubChem (CID 83012067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).