C10H15F2N3 — CID 83012141
2-(2,5-difluorophenyl)-2-(2,2-dimethylhydrazinyl)ethanamine (PubChem CID 83012141) has the molecular formula C10H15F2N3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-2-(2,2-dimethylhydrazinyl)ethanamine.
| Compound Name | 2-(2,5-difluorophenyl)-2-(2,2-dimethylhydrazinyl)ethanamine |
|---|---|
| PubChem CID | 83012141 |
| Molecular Formula | C10H15F2N3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-(2,5-difluorophenyl)-2-(2,2-dimethylhydrazinyl)ethanamine |
| SMILES | CN(C)NC(CN)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H15F2N3/c1-15(2)14-10(6-13)8-5-7(11)3-4-9(8)12/h3-5,10,14H,6,13H2,1-2H3 |
| InChIKey | ULRZCXDPAZSJQL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|