About [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine
[4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine (PubChem CID 83012232) has the molecular formula C10H23N3O
and a molecular weight of 201.31 g/mol. Its IUPAC name is [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine.
Molecular Properties
| Compound Name | [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine |
| PubChem CID | 83012232 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine |
| SMILES | CN(C)NC1(CN)CCOC(C)(C)C1 |
| InChI | InChI=1S/C10H23N3O/c1-9(2)7-10(8-11,5-6-14-9)12-13(3)4/h12H,5-8,11H2,1-4H3 |
| InChIKey | UXWGDTDBWYNZNS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine?
The IUPAC name of [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine (CID 83012232) is [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine.
What is the SMILES notation for [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine?
The canonical SMILES for [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine is CN(C)NC1(CN)CCOC(C)(C)C1.
What is the InChIKey of [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine?
The InChIKey is UXWGDTDBWYNZNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O/c1-9(2)7-10(8-11,5-6-14-9)12-13(3)4/h12H,5-8,11H2,1-4H3.
What are the key properties of [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine?
[4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine has a molecular weight of 201.31 g/mol, XLogP of 0.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-dimethylhydrazinyl)-2,2-dimethyloxan-4-yl]methanamine is sourced from PubChem (CID 83012232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).