About [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine
[1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine (PubChem CID 83012238) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine.
Molecular Properties
| Compound Name | [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine |
| PubChem CID | 83012238 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine |
| SMILES | CN(C)NC1(CN)CCC(C)(C)CC1 |
| InChI | InChI=1S/C11H25N3/c1-10(2)5-7-11(9-12,8-6-10)13-14(3)4/h13H,5-9,12H2,1-4H3 |
| InChIKey | NOIRVZBDXTWXSU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine?
The IUPAC name of [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine (CID 83012238) is [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine.
What is the SMILES notation for [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine?
The canonical SMILES for [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine is CN(C)NC1(CN)CCC(C)(C)CC1.
What is the InChIKey of [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine?
The InChIKey is NOIRVZBDXTWXSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3/c1-10(2)5-7-11(9-12,8-6-10)13-14(3)4/h13H,5-9,12H2,1-4H3.
What are the key properties of [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine?
[1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine has a molecular weight of 199.34 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethylhydrazinyl)-4,4-dimethylcyclohexyl]methanamine is sourced from PubChem (CID 83012238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).