C9H15N3O — CID 83012689
3-(2,2-dimethylhydrazinyl)-5-methoxyaniline (PubChem CID 83012689) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(2,2-dimethylhydrazinyl)-5-methoxyaniline.
| Compound Name | 3-(2,2-dimethylhydrazinyl)-5-methoxyaniline |
|---|---|
| PubChem CID | 83012689 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-(2,2-dimethylhydrazinyl)-5-methoxyaniline |
| SMILES | COc1cc(N)cc(NN(C)C)c1 |
| InChI | InChI=1S/C9H15N3O/c1-12(2)11-8-4-7(10)5-9(6-8)13-3/h4-6,11H,10H2,1-3H3 |
| InChIKey | HZCPYTZAGCFRMX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|