C9H15N3O2S — CID 83013451
2-amino-N',N',6-trimethylbenzenesulfonohydrazide (PubChem CID 83013451) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-amino-N',N',6-trimethylbenzenesulfonohydrazide.
| Compound Name | 2-amino-N',N',6-trimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 83013451 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-N',N',6-trimethylbenzenesulfonohydrazide |
| SMILES | Cc1cccc(N)c1S(=O)(=O)NN(C)C |
| InChI | InChI=1S/C9H15N3O2S/c1-7-5-4-6-8(10)9(7)15(13,14)11-12(2)3/h4-6,11H,10H2,1-3H3 |
| InChIKey | IKNSNMLLUDVPLB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|